90622-58-5 Usage
General Description
"Low Toxicity Processing Solvents" are chemicals that are used in various processes due to their relatively safer profile compared to traditional solvents. They are usually characterized by low volatility, low flammability, and low toxicity, making them a more environmentally-friendly and worker-safe choice. These solvents often have high flash points, meaning they evaporate slowly and are less likely to contribute to harmful air pollution. They are used in diverse industries such as coating, printing, cleaning, and more. The exact chemical composition varies widely depending on the specific applications, but common examples include water-based, bio-based, and certain types of glycol ethers.
Check Digit Verification of cas no
The CAS Registry Mumber 90622-58-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,6,2 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90622-58:
(7*9)+(6*0)+(5*6)+(4*2)+(3*2)+(2*5)+(1*8)=125
125 % 10 = 5
So 90622-58-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H28/c1-6-8-12(4)10-13(5)9-11(3)7-2/h11-13H,6-10H2,1-5H3
